C20H25NO3 — CID 892217
4-[(4-ethoxyphenoxy)methyl]-N,N-diethylbenzamide (PubChem CID 892217) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 4-[(4-ethoxyphenoxy)methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(4-ethoxyphenoxy)methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 892217 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 4-[(4-ethoxyphenoxy)methyl]-N,N-diethylbenzamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-4-21(5-2)20(22)17-9-7-16(8-10-17)15-24-19-13-11-18(12-14-19)23-6-3/h7-14H,4-6,15H2,1-3H3 |
| InChIKey | FOUXDMSQCFELCX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |