C29H47NO8S — CID 89221736
2-[[3-(2,2-dimethylpropanoyl)-7-(5-methoxy-2,3,3-trimethyl-4-oxohexan-2-yl)oxyheptanoyl]amino]-5-methylbenzenesulfonic acid (PubChem CID 89221736) has the molecular formula C29H47NO8S and a molecular weight of 569.76 g/mol. Its IUPAC name is 2-[[3-(2,2-dimethylpropanoyl)-7-(5-methoxy-2,3,3-trimethyl-4-oxohexan-2-yl)oxyheptanoyl]amino]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[[3-(2,2-dimethylpropanoyl)-7-(5-methoxy-2,3,3-trimethyl-4-oxohexan-2-yl)oxyheptanoyl]amino]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 89221736 |
| Molecular Formula | C29H47NO8S |
| Molecular Weight | 569.76 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 2-[[3-(2,2-dimethylpropanoyl)-7-(5-methoxy-2,3,3-trimethyl-4-oxohexan-2-yl)oxyheptanoyl]amino]-5-methylbenzenesulfonic acid |
| SMILES | COC(C)C(=O)C(C)(C)C(C)(C)OCCCCC(CC(=O)Nc1ccc(C)cc1S(=O)(=O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C29H47NO8S/c1-19-14-15-22(23(17-19)39(34,35)36)30-24(31)18-21(26(33)27(3,4)5)13-11-12-16-38-29(8,9)28(6,7)25(32)20(2)37-10/h14-15,17,20-21H,11-13,16,18H2,1-10H3,(H,30,31)(H,34,35,36) |
| InChIKey | KBAPCVCSGMWVNI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.76 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|