C8H13NO2 — CID 89221837
2-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]oxyethanol (PubChem CID 89221837) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]oxyethanol.
| Compound Name | 2-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]oxyethanol |
|---|---|
| PubChem CID | 89221837 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 2-[(1Z,3E)-1-aminohexa-1,3,5-trien-3-yl]oxyethanol |
| SMILES | C=C/C=C(\C=C/N)OCCO |
| InChI | InChI=1S/C8H13NO2/c1-2-3-8(4-5-9)11-7-6-10/h2-5,10H,1,6-7,9H2/b5-4-,8-3+ |
| InChIKey | ZESMPHODHAFRQY-UEQFWHKLSA-N |
| XLogP | 0.54 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|