About trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine
trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine (PubChem CID 89221861) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine.
Molecular Properties
| Compound Name | trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine |
| PubChem CID | 89221861 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine |
| SMILES | C=C1CC[C@H](C)C[C@@H]1N |
| InChI | InChI=1S/C8H15N/c1-6-3-4-7(2)8(9)5-6/h6,8H,2-5,9H2,1H3/t6-,8-/m0/s1 |
| InChIKey | XVNLBPGYXNLDRK-XPUUQOCRSA-N |
| XLogP | 1.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine?
The IUPAC name of trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine (CID 89221861) is trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine.
What is the SMILES notation for trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine?
The canonical SMILES for trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine is C=C1CC[C@H](C)C[C@@H]1N.
What is the InChIKey of trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine?
The InChIKey is XVNLBPGYXNLDRK-XPUUQOCRSA-N. The full InChI is InChI=1S/C8H15N/c1-6-3-4-7(2)8(9)5-6/h6,8H,2-5,9H2,1H3/t6-,8-/m0/s1.
What are the key properties of trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine?
trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine has a molecular weight of 125.21 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,5S)-5-methyl-2-methylidenecyclohexan-1-amine is sourced from PubChem (CID 89221861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).