About 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine
1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine (PubChem CID 89221880) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine.
Molecular Properties
| Compound Name | 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine |
| PubChem CID | 89221880 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine |
| SMILES | CCCOCCN1CCCc2ccc(N)cc21 |
| InChI | InChI=1S/C14H22N2O/c1-2-9-17-10-8-16-7-3-4-12-5-6-13(15)11-14(12)16/h5-6,11H,2-4,7-10,15H2,1H3 |
| InChIKey | JVUQLAXFRDZQGO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine?
The IUPAC name of 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine (CID 89221880) is 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine.
What is the SMILES notation for 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine?
The canonical SMILES for 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine is CCCOCCN1CCCc2ccc(N)cc21.
What is the InChIKey of 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine?
The InChIKey is JVUQLAXFRDZQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-2-9-17-10-8-16-7-3-4-12-5-6-13(15)11-14(12)16/h5-6,11H,2-4,7-10,15H2,1H3.
What are the key properties of 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine?
1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine has a molecular weight of 234.34 g/mol, XLogP of 2.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-propoxyethyl)-3,4-dihydro-2H-quinolin-7-amine is sourced from PubChem (CID 89221880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).