C10H11NO2 — CID 89222087
4,6-dimethyl-3,4-dihydro-1,3-benzoxazin-2-one (PubChem CID 89222087) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4,6-dimethyl-3,4-dihydro-1,3-benzoxazin-2-one.
| Compound Name | 4,6-dimethyl-3,4-dihydro-1,3-benzoxazin-2-one |
|---|---|
| PubChem CID | 89222087 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4,6-dimethyl-3,4-dihydro-1,3-benzoxazin-2-one |
| SMILES | Cc1ccc2c(c1)C(C)NC(=O)O2 |
| InChI | InChI=1S/C10H11NO2/c1-6-3-4-9-8(5-6)7(2)11-10(12)13-9/h3-5,7H,1-2H3,(H,11,12) |
| InChIKey | LSVORQXKIGOEME-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |