C17H23NS — CID 89222203
(5Z)-3-[(E,3R)-2,3-dimethylpent-1-enyl]sulfanyl-N-ethenylocta-1,2,5,7-tetraen-4-imine (PubChem CID 89222203) has the molecular formula C17H23NS and a molecular weight of 273.45 g/mol. Its IUPAC name is (5Z)-3-[(E,3R)-2,3-dimethylpent-1-enyl]sulfanyl-N-ethenylocta-1,2,5,7-tetraen-4-imine.
| Compound Name | (5Z)-3-[(E,3R)-2,3-dimethylpent-1-enyl]sulfanyl-N-ethenylocta-1,2,5,7-tetraen-4-imine |
|---|---|
| PubChem CID | 89222203 |
| Molecular Formula | C17H23NS |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (5Z)-3-[(E,3R)-2,3-dimethylpent-1-enyl]sulfanyl-N-ethenylocta-1,2,5,7-tetraen-4-imine |
| SMILES | C=C=C(S/C=C(\C)[C@H](C)CC)C(/C=C\C=C)=N/C=C |
| InChI | InChI=1S/C17H23NS/c1-7-11-12-16(18-10-4)17(9-3)19-13-15(6)14(5)8-2/h7,10-14H,1,3-4,8H2,2,5-6H3/b12-11-,15-13+,18-16+/t14-/m1/s1 |
| InChIKey | DRCKUJQGCCDWGG-UJLKGJEXSA-N |
| XLogP | 5.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|