C12H18N2 — CID 89222218
(3Z,5Z)-3-(1,2,3,6-tetrahydropyridin-4-yl)hepta-1,3,5-trien-4-amine (PubChem CID 89222218) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (3Z,5Z)-3-(1,2,3,6-tetrahydropyridin-4-yl)hepta-1,3,5-trien-4-amine.
| Compound Name | (3Z,5Z)-3-(1,2,3,6-tetrahydropyridin-4-yl)hepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 89222218 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (3Z,5Z)-3-(1,2,3,6-tetrahydropyridin-4-yl)hepta-1,3,5-trien-4-amine |
| SMILES | C=C/C(C1=CCNCC1)=C(N)\C=C/C |
| InChI | InChI=1S/C12H18N2/c1-3-5-12(13)11(4-2)10-6-8-14-9-7-10/h3-6,14H,2,7-9,13H2,1H3/b5-3-,12-11- |
| InChIKey | QQJASXWVAIMBNE-BVSOGULUSA-N |
| XLogP | 1.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|