About N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide
N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide (PubChem CID 89222292) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide |
| PubChem CID | 89222292 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCC1=CCCC=C1 |
| InChI | InChI=1S/C11H17NO/c1-9(2)11(13)12-8-10-6-4-3-5-7-10/h4,6-7,9H,3,5,8H2,1-2H3,(H,12,13) |
| InChIKey | VDCLOLBIFXBHJD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide (CID 89222292) is N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide is CC(C)C(=O)NCC1=CCCC=C1.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide?
The InChIKey is VDCLOLBIFXBHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-9(2)11(13)12-8-10-6-4-3-5-7-10/h4,6-7,9H,3,5,8H2,1-2H3,(H,12,13).
What are the key properties of N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide?
N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide has a molecular weight of 179.26 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylmethyl)-2-methylpropanamide is sourced from PubChem (CID 89222292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).