C13H13NO4 — CID 89222473
4-[[[(3Z)-4-carboxybuta-1,3-dien-2-yl]amino]methyl]benzoic acid (PubChem CID 89222473) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-[[[(3Z)-4-carboxybuta-1,3-dien-2-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[(3Z)-4-carboxybuta-1,3-dien-2-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 89222473 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 4-[[[(3Z)-4-carboxybuta-1,3-dien-2-yl]amino]methyl]benzoic acid |
| SMILES | C=C(/C=C\C(=O)O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H13NO4/c1-9(2-7-12(15)16)14-8-10-3-5-11(6-4-10)13(17)18/h2-7,14H,1,8H2,(H,15,16)(H,17,18)/b7-2- |
| InChIKey | XWPZIFYUJRUQSC-UQCOIBPSSA-N |
| XLogP | 1.63 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|