C7H10N4O2 — CID 89222833
7-amino-7-methyl-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine-4,6-dione (PubChem CID 89222833) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 7-amino-7-methyl-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine-4,6-dione.
| Compound Name | 7-amino-7-methyl-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 89222833 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 7-amino-7-methyl-3a,7a-dihydro-1H-imidazo[4,5-c]pyridine-4,6-dione |
| SMILES | CC1(N)C(=O)NC(=O)C2N=CNC21 |
| InChI | InChI=1S/C7H10N4O2/c1-7(8)4-3(9-2-10-4)5(12)11-6(7)13/h2-4H,8H2,1H3,(H,9,10)(H,11,12,13) |
| InChIKey | QUBFYWUQPZEZGY-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|