About (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene
(Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene (PubChem CID 89223127) has the molecular formula C11H22S
and a molecular weight of 186.36 g/mol. Its IUPAC name is (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene.
Molecular Properties
| Compound Name | (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene |
| PubChem CID | 89223127 |
| Molecular Formula | C11H22S |
| Molecular Weight | 186.36 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene |
| SMILES | CS/C=C\C(C)C(C)CC(C)C |
| InChI | InChI=1S/C11H22S/c1-9(2)8-11(4)10(3)6-7-12-5/h6-7,9-11H,8H2,1-5H3/b7-6- |
| InChIKey | BHXYBTYBAXNEFL-SREVYHEPSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene?
The IUPAC name of (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene (CID 89223127) is (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene.
What is the SMILES notation for (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene?
The canonical SMILES for (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene is CS/C=C\C(C)C(C)CC(C)C.
What is the InChIKey of (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene?
The InChIKey is BHXYBTYBAXNEFL-SREVYHEPSA-N. The full InChI is InChI=1S/C11H22S/c1-9(2)8-11(4)10(3)6-7-12-5/h6-7,9-11H,8H2,1-5H3/b7-6-.
What are the key properties of (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene?
(Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene has a molecular weight of 186.36 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4,6-trimethyl-1-methylsulfanylhept-1-ene is sourced from PubChem (CID 89223127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).