C13H22O — CID 89223204
4-methyl-3-propyl-1b,2,3,4,5,5a,6,6a-octahydro-1aH-indeno[1,2-b]oxirene (PubChem CID 89223204) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 4-methyl-3-propyl-1b,2,3,4,5,5a,6,6a-octahydro-1aH-indeno[1,2-b]oxirene.
| Compound Name | 4-methyl-3-propyl-1b,2,3,4,5,5a,6,6a-octahydro-1aH-indeno[1,2-b]oxirene |
|---|---|
| PubChem CID | 89223204 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 4-methyl-3-propyl-1b,2,3,4,5,5a,6,6a-octahydro-1aH-indeno[1,2-b]oxirene |
| SMILES | CCCC1CC2C(CC1C)CC1OC12 |
| InChI | InChI=1S/C13H22O/c1-3-4-9-6-11-10(5-8(9)2)7-12-13(11)14-12/h8-13H,3-7H2,1-2H3 |
| InChIKey | VWLBUWYUETZXQZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|