About CID 89223258
CID 89223258 (PubChem CID 89223258) has the molecular formula CBI2O
and a molecular weight of 292.63 g/mol.
Molecular Properties
| Compound Name | CID 89223258 |
| PubChem CID | 89223258 |
| Molecular Formula | CBI2O |
| Molecular Weight | 292.63 g/mol |
| Exact Mass | 292.81 |
| IUPAC Name | — |
| SMILES | O=C(I)[B]I |
| InChI | InChI=1S/CBI2O/c3-1(5)2-4 |
| InChIKey | YOMYEKHFEIAJQH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.63 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 89223258 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89223258?
The IUPAC name of CID 89223258 (CID 89223258) is not available.
What is the SMILES notation for CID 89223258?
The canonical SMILES for CID 89223258 is O=C(I)[B]I.
What is the InChIKey of CID 89223258?
The InChIKey is YOMYEKHFEIAJQH-UHFFFAOYSA-N. The full InChI is InChI=1S/CBI2O/c3-1(5)2-4.
What are the key properties of CID 89223258?
CID 89223258 has a molecular weight of 292.63 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89223258 is sourced from PubChem (CID 89223258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).