C28H23F6N5O2 — CID 89223418
[5-methoxy-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-15-yl]-[4-[(2,3,5-trifluorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 89223418) has the molecular formula C28H23F6N5O2 and a molecular weight of 575.51 g/mol. Its IUPAC name is [5-methoxy-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-15-yl]-[4-[(2,3,5-trifluorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [5-methoxy-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-15-yl]-[4-[(2,3,5-trifluorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 89223418 |
| Molecular Formula | C28H23F6N5O2 |
| Molecular Weight | 575.51 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | [5-methoxy-11-(trifluoromethyl)-12,13,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-15-yl]-[4-[(2,3,5-trifluorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc2c(c1)CCc1c-2nc2c(C(=O)N3CCN(Cc4cc(F)cc(F)c4F)CC3)cnn2c1C(F)(F)F |
| InChI | InChI=1S/C28H23F6N5O2/c1-41-18-3-5-19-15(11-18)2-4-20-24(19)36-26-21(13-35-39(26)25(20)28(32,33)34)27(40)38-8-6-37(7-9-38)14-16-10-17(29)12-22(30)23(16)31/h3,5,10-13H,2,4,6-9,14H2,1H3 |
| InChIKey | ZFKHXBQEKQIBHL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|