C29H43N — CID 89223612
2,5-bis(ethenyl)-1-[(5Z,9Z,11Z)-11-methyltetradeca-1,5,9,11,13-pentaen-3-yl]-3,4-dipropyl-2,3-dihydropyrrole (PubChem CID 89223612) has the molecular formula C29H43N and a molecular weight of 405.67 g/mol. Its IUPAC name is 2,5-bis(ethenyl)-1-[(5Z,9Z,11Z)-11-methyltetradeca-1,5,9,11,13-pentaen-3-yl]-3,4-dipropyl-2,3-dihydropyrrole.
| Compound Name | 2,5-bis(ethenyl)-1-[(5Z,9Z,11Z)-11-methyltetradeca-1,5,9,11,13-pentaen-3-yl]-3,4-dipropyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 89223612 |
| Molecular Formula | C29H43N |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.34 |
| IUPAC Name | 2,5-bis(ethenyl)-1-[(5Z,9Z,11Z)-11-methyltetradeca-1,5,9,11,13-pentaen-3-yl]-3,4-dipropyl-2,3-dihydropyrrole |
| SMILES | C=C/C=C(C)\C=C/CC/C=C\CC(C=C)N1C(C=C)=C(CCC)C(CCC)C1C=C |
| InChI | InChI=1S/C29H43N/c1-8-19-24(7)22-17-15-14-16-18-23-25(11-4)30-28(12-5)26(20-9-2)27(21-10-3)29(30)13-6/h8,11-13,16-19,22,25-26,28H,1,4-6,9-10,14-15,20-21,23H2,2-3,7H3/b18-16-,22-17-,24-19- |
| InChIKey | RTIDZLZNXAMKRN-RIQJUXCFSA-N |
| XLogP | 8.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|