C16H21NO2 — CID 89223770
(6E)-2-(1-hydroxycyclohexyl)-6-methoxynona-3,4,6,8-tetraenenitrile (PubChem CID 89223770) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (6E)-2-(1-hydroxycyclohexyl)-6-methoxynona-3,4,6,8-tetraenenitrile.
| Compound Name | (6E)-2-(1-hydroxycyclohexyl)-6-methoxynona-3,4,6,8-tetraenenitrile |
|---|---|
| PubChem CID | 89223770 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (6E)-2-(1-hydroxycyclohexyl)-6-methoxynona-3,4,6,8-tetraenenitrile |
| SMILES | C=C/C=C(\C=C=CC(C#N)C1(O)CCCCC1)OC |
| InChI | InChI=1S/C16H21NO2/c1-3-8-15(19-2)10-7-9-14(13-17)16(18)11-5-4-6-12-16/h3,8-10,14,18H,1,4-6,11-12H2,2H3/b15-8+ |
| InChIKey | HXCJJRAOOZBEKN-OVCLIPMQSA-N |
| XLogP | 3.25 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|