C23H21FN4O5 — CID 89224100
4-[3-[(1-ethylpyrazol-3-yl)carbamoyl]-5-[(2S)-1-hydroxypropan-2-yl]oxyphenoxy]-3-fluorobenzoyl cyanide (PubChem CID 89224100) has the molecular formula C23H21FN4O5 and a molecular weight of 452.44 g/mol. Its IUPAC name is 4-[3-[(1-ethylpyrazol-3-yl)carbamoyl]-5-[(2S)-1-hydroxypropan-2-yl]oxyphenoxy]-3-fluorobenzoyl cyanide.
| Compound Name | 4-[3-[(1-ethylpyrazol-3-yl)carbamoyl]-5-[(2S)-1-hydroxypropan-2-yl]oxyphenoxy]-3-fluorobenzoyl cyanide |
|---|---|
| PubChem CID | 89224100 |
| Molecular Formula | C23H21FN4O5 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 4-[3-[(1-ethylpyrazol-3-yl)carbamoyl]-5-[(2S)-1-hydroxypropan-2-yl]oxyphenoxy]-3-fluorobenzoyl cyanide |
| SMILES | CCn1ccc(NC(=O)c2cc(Oc3ccc(C(=O)C#N)cc3F)cc(O[C@@H](C)CO)c2)n1 |
| InChI | InChI=1S/C23H21FN4O5/c1-3-28-7-6-22(27-28)26-23(31)16-8-17(32-14(2)13-29)11-18(9-16)33-21-5-4-15(10-19(21)24)20(30)12-25/h4-11,14,29H,3,13H2,1-2H3,(H,26,27,31)/t14-/m0/s1 |
| InChIKey | CEBPLYONQLWSEY-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|