C12H14F2N2 — CID 89224155
(1E,3Z)-5-(3,5-difluorocyclohexa-1,5-dien-1-yl)hexa-1,3,5-triene-1,2-diamine (PubChem CID 89224155) has the molecular formula C12H14F2N2 and a molecular weight of 224.25 g/mol. Its IUPAC name is (1E,3Z)-5-(3,5-difluorocyclohexa-1,5-dien-1-yl)hexa-1,3,5-triene-1,2-diamine.
| Compound Name | (1E,3Z)-5-(3,5-difluorocyclohexa-1,5-dien-1-yl)hexa-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 89224155 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (1E,3Z)-5-(3,5-difluorocyclohexa-1,5-dien-1-yl)hexa-1,3,5-triene-1,2-diamine |
| SMILES | C=C(/C=C\C(N)=C/N)C1=CC(F)CC(F)=C1 |
| InChI | InChI=1S/C12H14F2N2/c1-8(2-3-12(16)7-15)9-4-10(13)6-11(14)5-9/h2-5,7,10H,1,6,15-16H2/b3-2-,12-7+ |
| InChIKey | XVHDGZJNLDDNBU-HDOHEQDKSA-N |
| XLogP | 2.38 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|