About butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate
butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate (PubChem CID 89224188) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate.
Molecular Properties
| Compound Name | butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate |
| PubChem CID | 89224188 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate |
| SMILES | CCCCOC(=O)CC1C[C@@H](C=O)OC(C)(C)C1 |
| InChI | InChI=1S/C14H24O4/c1-4-5-6-17-13(16)8-11-7-12(10-15)18-14(2,3)9-11/h10-12H,4-9H2,1-3H3/t11?,12-/m0/s1 |
| InChIKey | NJAPTBVBNILYPO-KIYNQFGBSA-N |
| XLogP | 2.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate?
The IUPAC name of butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate (CID 89224188) is butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate.
What is the SMILES notation for butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate?
The canonical SMILES for butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate is CCCCOC(=O)CC1C[C@@H](C=O)OC(C)(C)C1.
What is the InChIKey of butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate?
The InChIKey is NJAPTBVBNILYPO-KIYNQFGBSA-N. The full InChI is InChI=1S/C14H24O4/c1-4-5-6-17-13(16)8-11-7-12(10-15)18-14(2,3)9-11/h10-12H,4-9H2,1-3H3/t11?,12-/m0/s1.
What are the key properties of butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate?
butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate has a molecular weight of 256.34 g/mol, XLogP of 2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[(6S)-6-formyl-2,2-dimethyloxan-4-yl]acetate is sourced from PubChem (CID 89224188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).