C16H22N4OS — CID 89224216
2-(2,3-dihydro-1H-inden-2-ylamino)-N-(2-methoxyethyl)-4,5-dihydroimidazole-1-carbothioamide (PubChem CID 89224216) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-2-ylamino)-N-(2-methoxyethyl)-4,5-dihydroimidazole-1-carbothioamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-2-ylamino)-N-(2-methoxyethyl)-4,5-dihydroimidazole-1-carbothioamide |
|---|---|
| PubChem CID | 89224216 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-2-ylamino)-N-(2-methoxyethyl)-4,5-dihydroimidazole-1-carbothioamide |
| SMILES | COCCNC(=S)N1CCN=C1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H22N4OS/c1-21-9-7-18-16(22)20-8-6-17-15(20)19-14-10-12-4-2-3-5-13(12)11-14/h2-5,14H,6-11H2,1H3,(H,17,19)(H,18,22) |
| InChIKey | AOBIUBORDBLQJU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|