C42H34N10O3S — CID 89224446
5-[[6-[N-(1,3-benzothiazol-2-yl)-2-formylanilino]-2-(2-methoxyanilino)-4-methyl-3-pyridinyl]diazenyl]-1-(1,3-benzoxazol-2-yl)-3-tert-butylpyrazole-4-carbonitrile (PubChem CID 89224446) has the molecular formula C42H34N10O3S and a molecular weight of 758.87 g/mol. Its IUPAC name is 5-[[6-[N-(1,3-benzothiazol-2-yl)-2-formylanilino]-2-(2-methoxyanilino)-4-methyl-3-pyridinyl]diazenyl]-1-(1,3-benzoxazol-2-yl)-3-tert-butylpyrazole-4-carbonitrile.
| Compound Name | 5-[[6-[N-(1,3-benzothiazol-2-yl)-2-formylanilino]-2-(2-methoxyanilino)-4-methyl-3-pyridinyl]diazenyl]-1-(1,3-benzoxazol-2-yl)-3-tert-butylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 89224446 |
| Molecular Formula | C42H34N10O3S |
| Molecular Weight | 758.87 g/mol |
| Exact Mass | 758.25 |
| IUPAC Name | 5-[[6-[N-(1,3-benzothiazol-2-yl)-2-formylanilino]-2-(2-methoxyanilino)-4-methyl-3-pyridinyl]diazenyl]-1-(1,3-benzoxazol-2-yl)-3-tert-butylpyrazole-4-carbonitrile |
| SMILES | COc1ccccc1Nc1nc(N(c2nc3ccccc3s2)c2ccccc2C=O)cc(C)c1/N=N/c1c(C#N)c(C(C)(C)C)nn1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C42H34N10O3S/c1-25-22-35(51(31-18-10-6-14-26(31)24-53)41-46-30-17-9-13-21-34(30)56-41)47-38(44-28-15-7-11-19-32(28)54-5)36(25)48-49-39-27(23-43)37(42(2,3)4)50-52(39)40-45-29-16-8-12-20-33(29)55-40/h6-22,24H,1-5H3,(H,44,47)/b49-48+ |
| InChIKey | XNNNYJQHQTZPNV-DSIMXMMZSA-N |
| XLogP | 10.95 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.87 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|