C25H33FN6O3 — CID 89224529
8-ethyl-7-fluoro-1-[2-[4-[2-[(E)-[(3E)-3-hydrazinylidene-1,4-dioxan-2-ylidene]methyl]prop-2-enylamino]piperidin-1-yl]ethyl]-1,5-naphthyridin-2-one (PubChem CID 89224529) has the molecular formula C25H33FN6O3 and a molecular weight of 484.58 g/mol. Its IUPAC name is 8-ethyl-7-fluoro-1-[2-[4-[2-[(E)-[(3E)-3-hydrazinylidene-1,4-dioxan-2-ylidene]methyl]prop-2-enylamino]piperidin-1-yl]ethyl]-1,5-naphthyridin-2-one.
| Compound Name | 8-ethyl-7-fluoro-1-[2-[4-[2-[(E)-[(3E)-3-hydrazinylidene-1,4-dioxan-2-ylidene]methyl]prop-2-enylamino]piperidin-1-yl]ethyl]-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 89224529 |
| Molecular Formula | C25H33FN6O3 |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 8-ethyl-7-fluoro-1-[2-[4-[2-[(E)-[(3E)-3-hydrazinylidene-1,4-dioxan-2-ylidene]methyl]prop-2-enylamino]piperidin-1-yl]ethyl]-1,5-naphthyridin-2-one |
| SMILES | C=C(/C=C1/OCCOC1=NN)CNC1CCN(CCn2c(=O)ccc3ncc(F)c(CC)c32)CC1 |
| InChI | InChI=1S/C25H33FN6O3/c1-3-19-20(26)16-29-21-4-5-23(33)32(24(19)21)11-10-31-8-6-18(7-9-31)28-15-17(2)14-22-25(30-27)35-13-12-34-22/h4-5,14,16,18,28H,2-3,6-13,15,27H2,1H3/b22-14+,30-25? |
| InChIKey | GAIWBTJLXAHEPH-NKCMCOGPSA-N |
| XLogP | 1.91 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|