C20H20BN3O — CID 89224809
CID 89224809 (PubChem CID 89224809) has the molecular formula C20H20BN3O and a molecular weight of 329.21 g/mol.
| Compound Name | CID 89224809 |
|---|---|
| PubChem CID | 89224809 |
| Molecular Formula | C20H20BN3O |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(CNC(=O)Cc2c(C)nn(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C20H20BN3O/c1-14-19(15(2)24(23-14)18-9-4-3-5-10-18)12-20(25)22-13-16-7-6-8-17(21)11-16/h3-11H,12-13H2,1-2H3,(H,22,25) |
| InChIKey | ZLFOAMODLOXAQE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|