C29H48O3 — CID 89225011
(3aS,5aR,5bR,8R,9S,11aS)-3a-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-[(2S)-2-methyloxiran-2-yl]-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol (PubChem CID 89225011) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (3aS,5aR,5bR,8R,9S,11aS)-3a-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-[(2S)-2-methyloxiran-2-yl]-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol.
| Compound Name | (3aS,5aR,5bR,8R,9S,11aS)-3a-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-[(2S)-2-methyloxiran-2-yl]-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 89225011 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (3aS,5aR,5bR,8R,9S,11aS)-3a-(hydroxymethyl)-5a,5b,8,11a-tetramethyl-1-[(2S)-2-methyloxiran-2-yl]-2,3,4,5,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydro-1H-cyclopenta[a]chrysen-9-ol |
| SMILES | C[C@@H]1C2CC[C@]3(C)C(CCC4C5C([C@@]6(C)CO6)CC[C@]5(CO)CC[C@]43C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C29H48O3/c1-18-19-8-12-27(4)23(25(19,2)11-10-22(18)31)7-6-20-24-21(28(5)17-32-28)9-13-29(24,16-30)15-14-26(20,27)3/h18-24,30-31H,6-17H2,1-5H3/t18-,19?,20?,21?,22+,23?,24?,25+,26-,27-,28-,29-/m1/s1 |
| InChIKey | ACKRCXSNWYUGRR-VCSYFUFXSA-N |
| XLogP | 5.82 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|