C28H29ClF3N3O2 — CID 89225064
2-[(1E,3E)-1-amino-4-(trifluoromethyl)hexa-1,3,5-trienoxy]-N-[4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-2-methylpropanamide (PubChem CID 89225064) has the molecular formula C28H29ClF3N3O2 and a molecular weight of 532.01 g/mol. Its IUPAC name is 2-[(1E,3E)-1-amino-4-(trifluoromethyl)hexa-1,3,5-trienoxy]-N-[4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-2-methylpropanamide.
| Compound Name | 2-[(1E,3E)-1-amino-4-(trifluoromethyl)hexa-1,3,5-trienoxy]-N-[4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 89225064 |
| Molecular Formula | C28H29ClF3N3O2 |
| Molecular Weight | 532.01 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2-[(1E,3E)-1-amino-4-(trifluoromethyl)hexa-1,3,5-trienoxy]-N-[4-(4-chlorophenyl)-3-(3-cyanophenyl)butan-2-yl]-2-methylpropanamide |
| SMILES | C=C/C(=C\C=C(/N)OC(C)(C)C(=O)NC(C)C(Cc1ccc(Cl)cc1)c1cccc(C#N)c1)C(F)(F)F |
| InChI | InChI=1S/C28H29ClF3N3O2/c1-5-22(28(30,31)32)11-14-25(34)37-27(3,4)26(36)35-18(2)24(16-19-9-12-23(29)13-10-19)21-8-6-7-20(15-21)17-33/h5-15,18,24H,1,16,34H2,2-4H3,(H,35,36)/b22-11+,25-14+ |
| InChIKey | CDCNPGKVVKYRDL-HKPCAXFRSA-N |
| XLogP | 6.31 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.01 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|