C20H30NO3Si+ — CID 89225080
(4R,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-4-methyl-2-phenyl-5,6,7,8-tetrahydropyrrolizin-4-ium-3-one (PubChem CID 89225080) has the molecular formula C20H30NO3Si+ and a molecular weight of 360.55 g/mol. Its IUPAC name is (4R,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-4-methyl-2-phenyl-5,6,7,8-tetrahydropyrrolizin-4-ium-3-one.
| Compound Name | (4R,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-4-methyl-2-phenyl-5,6,7,8-tetrahydropyrrolizin-4-ium-3-one |
|---|---|
| PubChem CID | 89225080 |
| Molecular Formula | C20H30NO3Si+ |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (4R,6S,8R)-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-4-methyl-2-phenyl-5,6,7,8-tetrahydropyrrolizin-4-ium-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H]2C(O)=C(c3ccccc3)C(=O)[N@+]2(C)C1 |
| InChI | InChI=1S/C20H29NO3Si/c1-20(2,3)25(5,6)24-15-12-16-18(22)17(14-10-8-7-9-11-14)19(23)21(16,4)13-15/h7-11,15-16H,12-13H2,1-6H3/p+1/t15-,16+,21+/m0/s1 |
| InChIKey | UFMBGCQYYLAAKQ-GCKMJXCFSA-O |
| XLogP | 4.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|