C12H15F4NO3 — CID 892253
N-propan-2-yl-5-(2,2,3,3-tetrafluoropropoxymethyl)furan-2-carboxamide (PubChem CID 892253) has the molecular formula C12H15F4NO3 and a molecular weight of 297.25 g/mol. Its IUPAC name is N-propan-2-yl-5-(2,2,3,3-tetrafluoropropoxymethyl)furan-2-carboxamide.
| Compound Name | N-propan-2-yl-5-(2,2,3,3-tetrafluoropropoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 892253 |
| Molecular Formula | C12H15F4NO3 |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-propan-2-yl-5-(2,2,3,3-tetrafluoropropoxymethyl)furan-2-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc(COCC(F)(F)C(F)F)o1 |
| InChI | InChI=1S/C12H15F4NO3/c1-7(2)17-10(18)9-4-3-8(20-9)5-19-6-12(15,16)11(13)14/h3-4,7,11H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | BCPKBXQMWZYHOR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|