About 5-ethylpyrazine-2,3-diimine
5-ethylpyrazine-2,3-diimine (PubChem CID 89225463) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 5-ethylpyrazine-2,3-diimine.
Molecular Properties
| Compound Name | 5-ethylpyrazine-2,3-diimine |
| PubChem CID | 89225463 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 5-ethylpyrazine-2,3-diimine |
| SMILES | [H]/N=C1\N=CC(CC)=N\C1=N/[H] |
| InChI | InChI=1S/C6H8N4/c1-2-4-3-9-5(7)6(8)10-4/h3,7-8H,2H2,1H3/b7-5-,8-6- |
| InChIKey | QXRBLIQZLWFLQS-SFECMWDFSA-N |
| XLogP | 0.88 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylpyrazine-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylpyrazine-2,3-diimine?
The IUPAC name of 5-ethylpyrazine-2,3-diimine (CID 89225463) is 5-ethylpyrazine-2,3-diimine.
What is the SMILES notation for 5-ethylpyrazine-2,3-diimine?
The canonical SMILES for 5-ethylpyrazine-2,3-diimine is [H]/N=C1\N=CC(CC)=N\C1=N/[H].
What is the InChIKey of 5-ethylpyrazine-2,3-diimine?
The InChIKey is QXRBLIQZLWFLQS-SFECMWDFSA-N. The full InChI is InChI=1S/C6H8N4/c1-2-4-3-9-5(7)6(8)10-4/h3,7-8H,2H2,1H3/b7-5-,8-6-.
What are the key properties of 5-ethylpyrazine-2,3-diimine?
5-ethylpyrazine-2,3-diimine has a molecular weight of 136.16 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylpyrazine-2,3-diimine is sourced from PubChem (CID 89225463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).