About 3-methyl-6,7-dihydro-1,7-naphthyridine
3-methyl-6,7-dihydro-1,7-naphthyridine (PubChem CID 89225472) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-methyl-6,7-dihydro-1,7-naphthyridine.
Molecular Properties
| Compound Name | 3-methyl-6,7-dihydro-1,7-naphthyridine |
| PubChem CID | 89225472 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 3-methyl-6,7-dihydro-1,7-naphthyridine |
| SMILES | Cc1cnc2c(c1)=CCNC=2 |
| InChI | InChI=1S/C9H10N2/c1-7-4-8-2-3-10-6-9(8)11-5-7/h2,4-6,10H,3H2,1H3 |
| InChIKey | VEKFWTTYWDEBHX-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-6,7-dihydro-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6,7-dihydro-1,7-naphthyridine?
The IUPAC name of 3-methyl-6,7-dihydro-1,7-naphthyridine (CID 89225472) is 3-methyl-6,7-dihydro-1,7-naphthyridine.
What is the SMILES notation for 3-methyl-6,7-dihydro-1,7-naphthyridine?
The canonical SMILES for 3-methyl-6,7-dihydro-1,7-naphthyridine is Cc1cnc2c(c1)=CCNC=2.
What is the InChIKey of 3-methyl-6,7-dihydro-1,7-naphthyridine?
The InChIKey is VEKFWTTYWDEBHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-4-8-2-3-10-6-9(8)11-5-7/h2,4-6,10H,3H2,1H3.
What are the key properties of 3-methyl-6,7-dihydro-1,7-naphthyridine?
3-methyl-6,7-dihydro-1,7-naphthyridine has a molecular weight of 146.19 g/mol, XLogP of -0.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6,7-dihydro-1,7-naphthyridine is sourced from PubChem (CID 89225472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).