C16H28O4 — CID 89225986
(2Z)-2-[(2R,3S,4S)-3-ethyl-4-hydroxy-3-(hydroxymethyl)-2-(3-hydroxypropyl)-4-methylcyclohexylidene]propanal (PubChem CID 89225986) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2Z)-2-[(2R,3S,4S)-3-ethyl-4-hydroxy-3-(hydroxymethyl)-2-(3-hydroxypropyl)-4-methylcyclohexylidene]propanal.
| Compound Name | (2Z)-2-[(2R,3S,4S)-3-ethyl-4-hydroxy-3-(hydroxymethyl)-2-(3-hydroxypropyl)-4-methylcyclohexylidene]propanal |
|---|---|
| PubChem CID | 89225986 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2Z)-2-[(2R,3S,4S)-3-ethyl-4-hydroxy-3-(hydroxymethyl)-2-(3-hydroxypropyl)-4-methylcyclohexylidene]propanal |
| SMILES | CC[C@@]1(CO)[C@H](CCCO)/C(=C(/C)C=O)CC[C@]1(C)O |
| InChI | InChI=1S/C16H28O4/c1-4-16(11-19)14(6-5-9-17)13(12(2)10-18)7-8-15(16,3)20/h10,14,17,19-20H,4-9,11H2,1-3H3/b13-12-/t14-,15+,16-/m1/s1 |
| InChIKey | IKOZBHQWJFYGNL-CKQZQBEWSA-N |
| XLogP | 1.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|