C25H46O6 — CID 89226195
(2R,3S,4S,5R,6S)-2,3,4,5-tetrabutoxy-6-prop-2-enoxycyclohexan-1-one (PubChem CID 89226195) has the molecular formula C25H46O6 and a molecular weight of 442.64 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2,3,4,5-tetrabutoxy-6-prop-2-enoxycyclohexan-1-one.
| Compound Name | (2R,3S,4S,5R,6S)-2,3,4,5-tetrabutoxy-6-prop-2-enoxycyclohexan-1-one |
|---|---|
| PubChem CID | 89226195 |
| Molecular Formula | C25H46O6 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2,3,4,5-tetrabutoxy-6-prop-2-enoxycyclohexan-1-one |
| SMILES | C=CCO[C@@H]1C(=O)C(OCCCC)[C@@H](OCCCC)[C@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C25H46O6/c1-6-11-16-28-22-20(26)21(27-15-10-5)23(29-17-12-7-2)25(31-19-14-9-4)24(22)30-18-13-8-3/h10,21-25H,5-9,11-19H2,1-4H3/t21-,22?,23+,24-,25-/m1/s1 |
| InChIKey | FVTBHFQJCLIRQL-FTNPEVCGSA-N |
| XLogP | 4.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|