C13H17IN2 — CID 89226219
2-butyl-4-(cyclopenta-2,4-dien-1-ylidenemethyl)-5-iodo-4,5-dihydro-1H-imidazole (PubChem CID 89226219) has the molecular formula C13H17IN2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 2-butyl-4-(cyclopenta-2,4-dien-1-ylidenemethyl)-5-iodo-4,5-dihydro-1H-imidazole.
| Compound Name | 2-butyl-4-(cyclopenta-2,4-dien-1-ylidenemethyl)-5-iodo-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 89226219 |
| Molecular Formula | C13H17IN2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-butyl-4-(cyclopenta-2,4-dien-1-ylidenemethyl)-5-iodo-4,5-dihydro-1H-imidazole |
| SMILES | CCCCC1=NC(C=C2C=CC=C2)C(I)N1 |
| InChI | InChI=1S/C13H17IN2/c1-2-3-8-12-15-11(13(14)16-12)9-10-6-4-5-7-10/h4-7,9,11,13H,2-3,8H2,1H3,(H,15,16) |
| InChIKey | FCDJFZKUMMGRDH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|