About 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol
2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol (PubChem CID 89226429) has the molecular formula C7H6N2OS2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol.
Molecular Properties
| Compound Name | 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol |
| PubChem CID | 89226429 |
| Molecular Formula | C7H6N2OS2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol |
| SMILES | CSc1ncc2cc(S)oc2n1 |
| InChI | InChI=1S/C7H6N2OS2/c1-12-7-8-3-4-2-5(11)10-6(4)9-7/h2-3,11H,1H3 |
| InChIKey | KCYJVFZKFUPUPT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol?
The IUPAC name of 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol (CID 89226429) is 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol.
What is the SMILES notation for 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol?
The canonical SMILES for 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol is CSc1ncc2cc(S)oc2n1.
What is the InChIKey of 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol?
The InChIKey is KCYJVFZKFUPUPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS2/c1-12-7-8-3-4-2-5(11)10-6(4)9-7/h2-3,11H,1H3.
What are the key properties of 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol?
2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol has a molecular weight of 198.27 g/mol, XLogP of 2.23, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylfuro[2,3-d]pyrimidine-6-thiol is sourced from PubChem (CID 89226429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).