C21H14F7N3O3 — CID 89226656
(1R,6S)-8-(2,2,3,3,4,4,4-heptafluorobutanoyl)-4-naphthalen-1-yl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 89226656) has the molecular formula C21H14F7N3O3 and a molecular weight of 489.35 g/mol. Its IUPAC name is (1R,6S)-8-(2,2,3,3,4,4,4-heptafluorobutanoyl)-4-naphthalen-1-yl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,6S)-8-(2,2,3,3,4,4,4-heptafluorobutanoyl)-4-naphthalen-1-yl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 89226656 |
| Molecular Formula | C21H14F7N3O3 |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (1R,6S)-8-(2,2,3,3,4,4,4-heptafluorobutanoyl)-4-naphthalen-1-yl-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2C3C[C@H](CN3C(=O)C(F)(F)C(F)(F)C(F)(F)F)N2C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C21H14F7N3O3/c22-19(23,20(24,25)21(26,27)28)17(33)29-9-11-8-14(29)15-16(32)31(18(34)30(11)15)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11,14-15H,8-9H2/t11-,14?,15+/m1/s1 |
| InChIKey | KBSBYYFHUFGILG-QTWGFKIWSA-N |
| XLogP | 3.79 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|