C23H34N2O7Si — CID 89226795
(4R,5R,6S,7S,8S,9S)-5,7,8-trihydroxy-6-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-7-(hydroxymethyl)-2-oxo-1-phenylmethoxy-1-azaspiro[3.5]nonane-9-carbonitrile (PubChem CID 89226795) has the molecular formula C23H34N2O7Si and a molecular weight of 478.62 g/mol. Its IUPAC name is (4R,5R,6S,7S,8S,9S)-5,7,8-trihydroxy-6-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-7-(hydroxymethyl)-2-oxo-1-phenylmethoxy-1-azaspiro[3.5]nonane-9-carbonitrile.
| Compound Name | (4R,5R,6S,7S,8S,9S)-5,7,8-trihydroxy-6-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-7-(hydroxymethyl)-2-oxo-1-phenylmethoxy-1-azaspiro[3.5]nonane-9-carbonitrile |
|---|---|
| PubChem CID | 89226795 |
| Molecular Formula | C23H34N2O7Si |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (4R,5R,6S,7S,8S,9S)-5,7,8-trihydroxy-6-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-7-(hydroxymethyl)-2-oxo-1-phenylmethoxy-1-azaspiro[3.5]nonane-9-carbonitrile |
| SMILES | CC(C)(C[C@H]1[C@@H](O)[C@@]2(CC(=O)N2OCc2ccccc2)[C@@H](C#N)[C@H](O)[C@@]1(O)CO)[Si](C)(C)O |
| InChI | InChI=1S/C23H34N2O7Si/c1-21(2,33(3,4)31)10-16-19(28)22(17(12-24)20(29)23(16,30)14-26)11-18(27)25(22)32-13-15-8-6-5-7-9-15/h5-9,16-17,19-20,26,28-31H,10-11,13-14H2,1-4H3/t16-,17-,19+,20-,22+,23+/m0/s1 |
| InChIKey | YTLXKSPHNNIQIE-KWZWUOSESA-N |
| XLogP | 0.67 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|