C8H11NO2 — CID 89226958
(7aS)-3-methyl-3a,4,7,7a-tetrahydro-1,3-benzoxazol-2-one (PubChem CID 89226958) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (7aS)-3-methyl-3a,4,7,7a-tetrahydro-1,3-benzoxazol-2-one.
| Compound Name | (7aS)-3-methyl-3a,4,7,7a-tetrahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 89226958 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (7aS)-3-methyl-3a,4,7,7a-tetrahydro-1,3-benzoxazol-2-one |
| SMILES | CN1C(=O)O[C@H]2CC=CCC21 |
| InChI | InChI=1S/C8H11NO2/c1-9-6-4-2-3-5-7(6)11-8(9)10/h2-3,6-7H,4-5H2,1H3/t6?,7-/m0/s1 |
| InChIKey | ASQFGNZPRTUYFK-MLWJPKLSSA-N |
| XLogP | 1.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|