C14H17N — CID 89227013
(2E,4Z)-2-ethyl-1-phenylhexa-2,4-dien-1-imine (PubChem CID 89227013) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (2E,4Z)-2-ethyl-1-phenylhexa-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-2-ethyl-1-phenylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 89227013 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (2E,4Z)-2-ethyl-1-phenylhexa-2,4-dien-1-imine |
| SMILES | [H]/N=C(C(=C/C=C\C)/CC)\c1ccccc1 |
| InChI | InChI=1S/C14H17N/c1-3-5-9-12(4-2)14(15)13-10-7-6-8-11-13/h3,5-11,15H,4H2,1-2H3/b5-3-,12-9+,15-14- |
| InChIKey | BEBCVBYYDWFPOV-PNFLGPGCSA-N |
| XLogP | 3.97 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|