C8H10F2 — CID 89227259
(1Z,3Z,5E)-1,2-difluoro-3-methylhepta-1,3,5-triene (PubChem CID 89227259) has the molecular formula C8H10F2 and a molecular weight of 144.16 g/mol. Its IUPAC name is (1Z,3Z,5E)-1,2-difluoro-3-methylhepta-1,3,5-triene.
| Compound Name | (1Z,3Z,5E)-1,2-difluoro-3-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89227259 |
| Molecular Formula | C8H10F2 |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (1Z,3Z,5E)-1,2-difluoro-3-methylhepta-1,3,5-triene |
| SMILES | C/C=C/C=C(C)\C(F)=C\F |
| InChI | InChI=1S/C8H10F2/c1-3-4-5-7(2)8(10)6-9/h3-6H,1-2H3/b4-3+,7-5-,8-6- |
| InChIKey | XMEAOMLQBMGWCX-DVLZSMJMSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|