C25H46O4 — CID 89227404
2-[2-(2,2-dimethylpropanoyl)pent-4-enoxy]-2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]octan-4-one (PubChem CID 89227404) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylpropanoyl)pent-4-enoxy]-2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]octan-4-one.
| Compound Name | 2-[2-(2,2-dimethylpropanoyl)pent-4-enoxy]-2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]octan-4-one |
|---|---|
| PubChem CID | 89227404 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | 2-[2-(2,2-dimethylpropanoyl)pent-4-enoxy]-2,3,3-trimethyl-8-[(2-methylpropan-2-yl)oxy]octan-4-one |
| SMILES | C=CCC(COC(C)(C)C(C)(C)C(=O)CCCCOC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C25H46O4/c1-12-15-19(21(27)22(2,3)4)18-29-25(10,11)24(8,9)20(26)16-13-14-17-28-23(5,6)7/h12,19H,1,13-18H2,2-11H3 |
| InChIKey | XERIIQGCOFXCFM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|