About 7-ethyl-4-methyl-3,4-dihydro-2H-azepine
7-ethyl-4-methyl-3,4-dihydro-2H-azepine (PubChem CID 89227477) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 7-ethyl-4-methyl-3,4-dihydro-2H-azepine.
Molecular Properties
| Compound Name | 7-ethyl-4-methyl-3,4-dihydro-2H-azepine |
| PubChem CID | 89227477 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 7-ethyl-4-methyl-3,4-dihydro-2H-azepine |
| SMILES | CCC1=NCCC(C)C=C1 |
| InChI | InChI=1S/C9H15N/c1-3-9-5-4-8(2)6-7-10-9/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | LETRWRSRDDPXTL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-ethyl-4-methyl-3,4-dihydro-2H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-4-methyl-3,4-dihydro-2H-azepine?
The IUPAC name of 7-ethyl-4-methyl-3,4-dihydro-2H-azepine (CID 89227477) is 7-ethyl-4-methyl-3,4-dihydro-2H-azepine.
What is the SMILES notation for 7-ethyl-4-methyl-3,4-dihydro-2H-azepine?
The canonical SMILES for 7-ethyl-4-methyl-3,4-dihydro-2H-azepine is CCC1=NCCC(C)C=C1.
What is the InChIKey of 7-ethyl-4-methyl-3,4-dihydro-2H-azepine?
The InChIKey is LETRWRSRDDPXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-3-9-5-4-8(2)6-7-10-9/h4-5,8H,3,6-7H2,1-2H3.
What are the key properties of 7-ethyl-4-methyl-3,4-dihydro-2H-azepine?
7-ethyl-4-methyl-3,4-dihydro-2H-azepine has a molecular weight of 137.23 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-4-methyl-3,4-dihydro-2H-azepine is sourced from PubChem (CID 89227477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).