C27H22F6N2O6 — CID 89227769
2-[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-3-(2,2,2-trifluoroacetyl)indol-4-yl]oxyprop-2-enoic acid (PubChem CID 89227769) has the molecular formula C27H22F6N2O6 and a molecular weight of 584.47 g/mol. Its IUPAC name is 2-[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-3-(2,2,2-trifluoroacetyl)indol-4-yl]oxyprop-2-enoic acid.
| Compound Name | 2-[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-3-(2,2,2-trifluoroacetyl)indol-4-yl]oxyprop-2-enoic acid |
|---|---|
| PubChem CID | 89227769 |
| Molecular Formula | C27H22F6N2O6 |
| Molecular Weight | 584.47 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 2-[1-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]-3-(2,2,2-trifluoroacetyl)indol-4-yl]oxyprop-2-enoic acid |
| SMILES | C=C(Oc1cccc2c1c(C(=O)C(F)(F)F)cn2CCCOc1ccc2c(C(F)(F)F)noc2c1CCC)C(=O)O |
| InChI | InChI=1S/C27H22F6N2O6/c1-3-6-15-19(10-9-16-22(15)41-34-23(16)26(28,29)30)39-12-5-11-35-13-17(24(36)27(31,32)33)21-18(35)7-4-8-20(21)40-14(2)25(37)38/h4,7-10,13H,2-3,5-6,11-12H2,1H3,(H,37,38) |
| InChIKey | VMNNDXJIYFGCCD-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.47 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|