About (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol
(4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol (PubChem CID 89228022) has the molecular formula C13H20S
and a molecular weight of 208.37 g/mol. Its IUPAC name is (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol.
Molecular Properties
| Compound Name | (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol |
| PubChem CID | 89228022 |
| Molecular Formula | C13H20S |
| Molecular Weight | 208.37 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol |
| SMILES | C=C/C=C(\CCCS)C1=CC(C)CC1 |
| InChI | InChI=1S/C13H20S/c1-3-5-12(6-4-9-14)13-8-7-11(2)10-13/h3,5,10-11,14H,1,4,6-9H2,2H3/b12-5+ |
| InChIKey | WASVSYAZSBARTD-LFYBBSHMSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol?
The IUPAC name of (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol (CID 89228022) is (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol.
What is the SMILES notation for (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol?
The canonical SMILES for (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol is C=C/C=C(\CCCS)C1=CC(C)CC1.
What is the InChIKey of (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol?
The InChIKey is WASVSYAZSBARTD-LFYBBSHMSA-N. The full InChI is InChI=1S/C13H20S/c1-3-5-12(6-4-9-14)13-8-7-11(2)10-13/h3,5,10-11,14H,1,4,6-9H2,2H3/b12-5+.
What are the key properties of (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol?
(4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol has a molecular weight of 208.37 g/mol, XLogP of 4.17, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-(3-methylcyclopenten-1-yl)hepta-4,6-diene-1-thiol is sourced from PubChem (CID 89228022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).