About 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine
6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine (PubChem CID 89228504) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine.
Analyze 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine?
The IUPAC name of 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine (CID 89228504) is 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine.
What is the SMILES notation for 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine?
The canonical SMILES for 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine is CC1C=CC2=C(OCCCO2)C1C.
What is the InChIKey of 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine?
The InChIKey is NDPIHNOXDFFKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-8-4-5-10-11(9(8)2)13-7-3-6-12-10/h4-5,8-9H,3,6-7H2,1-2H3.
What are the key properties of 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine?
6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine has a molecular weight of 180.25 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-3,4,6,7-tetrahydro-2H-1,5-benzodioxepine is sourced from PubChem (CID 89228504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).