About 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene
2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene (PubChem CID 89228604) has the molecular formula C9H14S
and a molecular weight of 154.28 g/mol. Its IUPAC name is 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene.
Analyze 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene?
The IUPAC name of 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene (CID 89228604) is 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene.
What is the SMILES notation for 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene?
The canonical SMILES for 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene is CC1CC2=C(CCCC2)S1.
What is the InChIKey of 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene?
The InChIKey is CVCADXDRBFCYCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14S/c1-7-6-8-4-2-3-5-9(8)10-7/h7H,2-6H2,1H3.
What are the key properties of 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene?
2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene has a molecular weight of 154.28 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3,4,5,6,7-hexahydro-1-benzothiophene is sourced from PubChem (CID 89228604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).