C20H30F4O — CID 89228841
1-[[(3E)-4,5-difluorohexa-1,3,5-trien-2-yl]oxy-difluoromethyl]-4-(5-methylhexan-2-yl)cyclohexane (PubChem CID 89228841) has the molecular formula C20H30F4O and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-[[(3E)-4,5-difluorohexa-1,3,5-trien-2-yl]oxy-difluoromethyl]-4-(5-methylhexan-2-yl)cyclohexane.
| Compound Name | 1-[[(3E)-4,5-difluorohexa-1,3,5-trien-2-yl]oxy-difluoromethyl]-4-(5-methylhexan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 89228841 |
| Molecular Formula | C20H30F4O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-[[(3E)-4,5-difluorohexa-1,3,5-trien-2-yl]oxy-difluoromethyl]-4-(5-methylhexan-2-yl)cyclohexane |
| SMILES | C=C(/C=C(/F)C(=C)F)OC(F)(F)C1CCC(C(C)CCC(C)C)CC1 |
| InChI | InChI=1S/C20H30F4O/c1-13(2)6-7-14(3)17-8-10-18(11-9-17)20(23,24)25-15(4)12-19(22)16(5)21/h12-14,17-18H,4-11H2,1-3H3/b19-12+ |
| InChIKey | JGEHQRZIGMLSRA-XDHOZWIPSA-N |
| XLogP | 7.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|