About 4-ethyl-1,2,3-trimethylpiperidine
4-ethyl-1,2,3-trimethylpiperidine (PubChem CID 89228905) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 4-ethyl-1,2,3-trimethylpiperidine.
Molecular Properties
| Compound Name | 4-ethyl-1,2,3-trimethylpiperidine |
| PubChem CID | 89228905 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 4-ethyl-1,2,3-trimethylpiperidine |
| SMILES | CCC1CCN(C)C(C)C1C |
| InChI | InChI=1S/C10H21N/c1-5-10-6-7-11(4)9(3)8(10)2/h8-10H,5-7H2,1-4H3 |
| InChIKey | JHUQNYTVLTYATK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-1,2,3-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,2,3-trimethylpiperidine?
The IUPAC name of 4-ethyl-1,2,3-trimethylpiperidine (CID 89228905) is 4-ethyl-1,2,3-trimethylpiperidine.
What is the SMILES notation for 4-ethyl-1,2,3-trimethylpiperidine?
The canonical SMILES for 4-ethyl-1,2,3-trimethylpiperidine is CCC1CCN(C)C(C)C1C.
What is the InChIKey of 4-ethyl-1,2,3-trimethylpiperidine?
The InChIKey is JHUQNYTVLTYATK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-5-10-6-7-11(4)9(3)8(10)2/h8-10H,5-7H2,1-4H3.
What are the key properties of 4-ethyl-1,2,3-trimethylpiperidine?
4-ethyl-1,2,3-trimethylpiperidine has a molecular weight of 155.28 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,2,3-trimethylpiperidine is sourced from PubChem (CID 89228905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).