About 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one
4-(2-oxobutyl)-1,3-dihydroimidazol-2-one (PubChem CID 89228982) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one |
| PubChem CID | 89228982 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one |
| SMILES | CCC(=O)Cc1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O2/c1-2-6(10)3-5-4-8-7(11)9-5/h4H,2-3H2,1H3,(H2,8,9,11) |
| InChIKey | CKMFBYBRVHLJHA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one (CID 89228982) is 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one is CCC(=O)Cc1c[nH]c(=O)[nH]1.
What is the InChIKey of 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one?
The InChIKey is CKMFBYBRVHLJHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-2-6(10)3-5-4-8-7(11)9-5/h4H,2-3H2,1H3,(H2,8,9,11).
What are the key properties of 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one?
4-(2-oxobutyl)-1,3-dihydroimidazol-2-one has a molecular weight of 154.17 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxobutyl)-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 89228982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).