C19H17F3N2O5 — CID 89229073
(2S,4R)-1-prop-1-en-2-yloxycarbonyl-4-[2-(trifluoromethyl)quinolin-4-yl]oxypyrrolidine-2-carboxylic acid (PubChem CID 89229073) has the molecular formula C19H17F3N2O5 and a molecular weight of 410.35 g/mol. Its IUPAC name is (2S,4R)-1-prop-1-en-2-yloxycarbonyl-4-[2-(trifluoromethyl)quinolin-4-yl]oxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-prop-1-en-2-yloxycarbonyl-4-[2-(trifluoromethyl)quinolin-4-yl]oxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 89229073 |
| Molecular Formula | C19H17F3N2O5 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (2S,4R)-1-prop-1-en-2-yloxycarbonyl-4-[2-(trifluoromethyl)quinolin-4-yl]oxypyrrolidine-2-carboxylic acid |
| SMILES | C=C(C)OC(=O)N1C[C@H](Oc2cc(C(F)(F)F)nc3ccccc23)C[C@H]1C(=O)O |
| InChI | InChI=1S/C19H17F3N2O5/c1-10(2)28-18(27)24-9-11(7-14(24)17(25)26)29-15-8-16(19(20,21)22)23-13-6-4-3-5-12(13)15/h3-6,8,11,14H,1,7,9H2,2H3,(H,25,26)/t11-,14+/m1/s1 |
| InChIKey | MNQSOPAQWQUNGJ-RISCZKNCSA-N |
| XLogP | 3.83 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|