C18H10FN3OS — CID 89229284
1-[(2-ethynyl-3-pyridinyl)methylsulfanyl]-7-fluoro-3-oxo-2H-isoquinoline-4-carbonitrile (PubChem CID 89229284) has the molecular formula C18H10FN3OS and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-[(2-ethynyl-3-pyridinyl)methylsulfanyl]-7-fluoro-3-oxo-2H-isoquinoline-4-carbonitrile.
| Compound Name | 1-[(2-ethynyl-3-pyridinyl)methylsulfanyl]-7-fluoro-3-oxo-2H-isoquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 89229284 |
| Molecular Formula | C18H10FN3OS |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[(2-ethynyl-3-pyridinyl)methylsulfanyl]-7-fluoro-3-oxo-2H-isoquinoline-4-carbonitrile |
| SMILES | C#Cc1ncccc1CSc1[nH]c(=O)c(C#N)c2ccc(F)cc12 |
| InChI | InChI=1S/C18H10FN3OS/c1-2-16-11(4-3-7-21-16)10-24-18-14-8-12(19)5-6-13(14)15(9-20)17(23)22-18/h1,3-8H,10H2,(H,22,23) |
| InChIKey | HHMNUBNJXDOZAD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|